C24H24 — CID 164529280
1-[(E)-2-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl]-4-[(E)-2-phenylethenyl]benzene (PubChem CID 164529280) has the molecular formula C24H24 and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(E)-2-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl]-4-[(E)-2-phenylethenyl]benzene.
| Compound Name | 1-[(E)-2-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl]-4-[(E)-2-phenylethenyl]benzene |
|---|---|
| PubChem CID | 164529280 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-[(E)-2-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl]-4-[(E)-2-phenylethenyl]benzene |
| SMILES | CCC1=CC=C(/C=C/c2ccc(/C=C/c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H24/c1-2-20-8-10-22(11-9-20)14-15-24-18-16-23(17-19-24)13-12-21-6-4-3-5-7-21/h3-8,10,12-19H,2,9,11H2,1H3/b13-12+,15-14+ |
| InChIKey | VRURFFDXGBYPMT-SQIWNDBBSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|