C20H22N2 — CID 174421123
benzene;5-(2-phenylethenyl)cyclohexa-2,4-diene-1,1-diamine (PubChem CID 174421123) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is benzene;5-(2-phenylethenyl)cyclohexa-2,4-diene-1,1-diamine.
| Compound Name | benzene;5-(2-phenylethenyl)cyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 174421123 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | benzene;5-(2-phenylethenyl)cyclohexa-2,4-diene-1,1-diamine |
| SMILES | NC1(N)C=CC=C(C=Cc2ccccc2)C1.c1ccccc1 |
| InChI | InChI=1S/C14H16N2.C6H6/c15-14(16)10-4-7-13(11-14)9-8-12-5-2-1-3-6-12;1-2-4-6-5-3-1/h1-10H,11,15-16H2;1-6H |
| InChIKey | AFWSIDAAFSQBMV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|