C6H12N4 — CID 141102727
5-hydrazinylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 141102727) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 5-hydrazinylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 5-hydrazinylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 141102727 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 5-hydrazinylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | NNC1=CC=CC(N)(N)C1 |
| InChI | InChI=1S/C6H12N4/c7-6(8)3-1-2-5(4-6)10-9/h1-3,10H,4,7-9H2 |
| InChIKey | SUVYVWRMRMPSOS-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|