About 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile
5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile (PubChem CID 140662742) has the molecular formula C7H7BrN2
and a molecular weight of 199.05 g/mol. Its IUPAC name is 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 140662742 |
| Molecular Formula | C7H7BrN2 |
| Molecular Weight | 199.05 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile |
| SMILES | N#CC1(Br)C=CC=C(N)C1 |
| InChI | InChI=1S/C7H7BrN2/c8-7(5-9)3-1-2-6(10)4-7/h1-3H,4,10H2 |
| InChIKey | WUQAPYLRFSGEKE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.05 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile (CID 140662742) is 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile is N#CC1(Br)C=CC=C(N)C1.
What is the InChIKey of 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is WUQAPYLRFSGEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2/c8-7(5-9)3-1-2-6(10)4-7/h1-3H,4,10H2.
What are the key properties of 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile?
5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 199.05 g/mol, XLogP of 1.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-bromocyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 140662742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).