C7H10BrN — CID 139793970
5-bromo-5-methylcyclohexa-1,3-dien-1-amine (PubChem CID 139793970) has the molecular formula C7H10BrN and a molecular weight of 188.07 g/mol. Its IUPAC name is 5-bromo-5-methylcyclohexa-1,3-dien-1-amine.
| Compound Name | 5-bromo-5-methylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 139793970 |
| Molecular Formula | C7H10BrN |
| Molecular Weight | 188.07 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 5-bromo-5-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CC1(Br)C=CC=C(N)C1 |
| InChI | InChI=1S/C7H10BrN/c1-7(8)4-2-3-6(9)5-7/h2-4H,5,9H2,1H3 |
| InChIKey | AGBCVYHTXOFMFP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.07 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|