C6H9BrN2 — CID 23080731
1-bromocyclohexa-3,5-diene-1,3-diamine (PubChem CID 23080731) has the molecular formula C6H9BrN2 and a molecular weight of 189.06 g/mol. Its IUPAC name is 1-bromocyclohexa-3,5-diene-1,3-diamine.
| Compound Name | 1-bromocyclohexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 23080731 |
| Molecular Formula | C6H9BrN2 |
| Molecular Weight | 189.06 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 1-bromocyclohexa-3,5-diene-1,3-diamine |
| SMILES | NC1=CC=CC(N)(Br)C1 |
| InChI | InChI=1S/C6H9BrN2/c7-6(9)3-1-2-5(8)4-6/h1-3H,4,8-9H2 |
| InChIKey | RZLVVGNFZACJMP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.06 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|