C6H7BrFN — CID 140501917
4-bromo-4-fluorocyclohexa-1,5-dien-1-amine (PubChem CID 140501917) has the molecular formula C6H7BrFN and a molecular weight of 192.03 g/mol. Its IUPAC name is 4-bromo-4-fluorocyclohexa-1,5-dien-1-amine.
| Compound Name | 4-bromo-4-fluorocyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 140501917 |
| Molecular Formula | C6H7BrFN |
| Molecular Weight | 192.03 g/mol |
| Exact Mass | 190.97 |
| IUPAC Name | 4-bromo-4-fluorocyclohexa-1,5-dien-1-amine |
| SMILES | NC1=CCC(F)(Br)C=C1 |
| InChI | InChI=1S/C6H7BrFN/c7-6(8)3-1-5(9)2-4-6/h1-3H,4,9H2 |
| InChIKey | PHWJAELMHGUDLC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.03 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|