C6H6BrF2N — CID 141478607
4-bromo-2,4-difluorocyclohexa-1,5-dien-1-amine (PubChem CID 141478607) has the molecular formula C6H6BrF2N and a molecular weight of 210.02 g/mol. Its IUPAC name is 4-bromo-2,4-difluorocyclohexa-1,5-dien-1-amine.
| Compound Name | 4-bromo-2,4-difluorocyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 141478607 |
| Molecular Formula | C6H6BrF2N |
| Molecular Weight | 210.02 g/mol |
| Exact Mass | 208.97 |
| IUPAC Name | 4-bromo-2,4-difluorocyclohexa-1,5-dien-1-amine |
| SMILES | NC1=C(F)CC(F)(Br)C=C1 |
| InChI | InChI=1S/C6H6BrF2N/c7-6(9)2-1-5(10)4(8)3-6/h1-2H,3,10H2 |
| InChIKey | XGUWDJKCDUNNSO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.02 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|