C6H6Br2F2N2 — CID 141308071
5,6-dibromo-4,5-difluorocyclohexa-1,3-diene-1,2-diamine (PubChem CID 141308071) has the molecular formula C6H6Br2F2N2 and a molecular weight of 303.93 g/mol. Its IUPAC name is 5,6-dibromo-4,5-difluorocyclohexa-1,3-diene-1,2-diamine.
| Compound Name | 5,6-dibromo-4,5-difluorocyclohexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 141308071 |
| Molecular Formula | C6H6Br2F2N2 |
| Molecular Weight | 303.93 g/mol |
| Exact Mass | 301.89 |
| IUPAC Name | 5,6-dibromo-4,5-difluorocyclohexa-1,3-diene-1,2-diamine |
| SMILES | NC1=C(N)C(Br)C(F)(Br)C(F)=C1 |
| InChI | InChI=1S/C6H6Br2F2N2/c7-5-4(12)2(11)1-3(9)6(5,8)10/h1,5H,11-12H2 |
| InChIKey | JTPKUEQWLQKAIB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.93 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|