C12H8Cl4N8 — CID 175900253
3-N,1-bis(4,6-dichloro-1,3,5-triazin-2-yl)cyclohexa-3,5-diene-1,3-diamine (PubChem CID 175900253) has the molecular formula C12H8Cl4N8 and a molecular weight of 406.06 g/mol. Its IUPAC name is 3-N,1-bis(4,6-dichloro-1,3,5-triazin-2-yl)cyclohexa-3,5-diene-1,3-diamine.
| Compound Name | 3-N,1-bis(4,6-dichloro-1,3,5-triazin-2-yl)cyclohexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 175900253 |
| Molecular Formula | C12H8Cl4N8 |
| Molecular Weight | 406.06 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 3-N,1-bis(4,6-dichloro-1,3,5-triazin-2-yl)cyclohexa-3,5-diene-1,3-diamine |
| SMILES | NC1(c2nc(Cl)nc(Cl)n2)C=CC=C(Nc2nc(Cl)nc(Cl)n2)C1 |
| InChI | InChI=1S/C12H8Cl4N8/c13-7-19-6(20-8(14)21-7)12(17)3-1-2-5(4-12)18-11-23-9(15)22-10(16)24-11/h1-3H,4,17H2,(H,18,22,23,24) |
| InChIKey | DIEUBHMWVPIOBG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.06 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |