C10H8Cl3N5S2 — CID 88626934
carbamodithioic acid;4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine (PubChem CID 88626934) has the molecular formula C10H8Cl3N5S2 and a molecular weight of 368.70 g/mol. Its IUPAC name is carbamodithioic acid;4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | carbamodithioic acid;4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 88626934 |
| Molecular Formula | C10H8Cl3N5S2 |
| Molecular Weight | 368.70 g/mol |
| Exact Mass | 366.93 |
| IUPAC Name | carbamodithioic acid;4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(Nc2ccccc2Cl)n1.NC(=S)S |
| InChI | InChI=1S/C9H5Cl3N4.CH3NS2/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9;2-1(3)4/h1-4H,(H,13,14,15,16);(H3,2,3,4) |
| InChIKey | UMPIVSVXEDNFMD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|