C9H11Cl3N4O3 — CID 173416428
4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;trihydrate (PubChem CID 173416428) has the molecular formula C9H11Cl3N4O3 and a molecular weight of 329.57 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;trihydrate.
| Compound Name | 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;trihydrate |
|---|---|
| PubChem CID | 173416428 |
| Molecular Formula | C9H11Cl3N4O3 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;trihydrate |
| SMILES | Clc1nc(Cl)nc(Nc2ccccc2Cl)n1.O.O.O |
| InChI | InChI=1S/C9H5Cl3N4.3H2O/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9;;;/h1-4H,(H,13,14,15,16);3*1H2 |
| InChIKey | GJAUYLBNBKUSIZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |