C14H16Cl3N5 — CID 22708768
4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;piperidine (PubChem CID 22708768) has the molecular formula C14H16Cl3N5 and a molecular weight of 360.68 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;piperidine.
| Compound Name | 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;piperidine |
|---|---|
| PubChem CID | 22708768 |
| Molecular Formula | C14H16Cl3N5 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;piperidine |
| SMILES | C1CCNCC1.Clc1nc(Cl)nc(Nc2ccccc2Cl)n1 |
| InChI | InChI=1S/C9H5Cl3N4.C5H11N/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9;1-2-4-6-5-3-1/h1-4H,(H,13,14,15,16);6H,1-5H2 |
| InChIKey | WDVTUECWYAXJNY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |