C9H7ClN4 — CID 135039645
N-(2-chlorophenyl)-1,2,4-triazin-3-amine (PubChem CID 135039645) has the molecular formula C9H7ClN4 and a molecular weight of 206.64 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1,2,4-triazin-3-amine.
| Compound Name | N-(2-chlorophenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 135039645 |
| Molecular Formula | C9H7ClN4 |
| Molecular Weight | 206.64 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | N-(2-chlorophenyl)-1,2,4-triazin-3-amine |
| SMILES | Clc1ccccc1Nc1nccnn1 |
| InChI | InChI=1S/C9H7ClN4/c10-7-3-1-2-4-8(7)13-9-11-5-6-12-14-9/h1-6H,(H,11,13,14) |
| InChIKey | HMDLFNLKEUPNCE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |