C15H21Cl4N9 — CID 176526392
2-butyl-1-carbamimidoylguanidine;4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;hydrochloride (PubChem CID 176526392) has the molecular formula C15H21Cl4N9 and a molecular weight of 469.21 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;hydrochloride.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 176526392 |
| Molecular Formula | C15H21Cl4N9 |
| Molecular Weight | 469.21 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine;hydrochloride |
| SMILES | Cl.Clc1nc(Cl)nc(Nc2ccccc2Cl)n1.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C9H5Cl3N4.C6H15N5.ClH/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9;1-2-3-4-10-6(9)11-5(7)8;/h1-4H,(H,13,14,15,16);2-4H2,1H3,(H6,7,8,9,10,11);1H |
| InChIKey | WGSFHDHTGUZPJT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|