C3H2Cl2N4O — CID 89401722
N-(4,6-dichloro-1,3,5-triazin-2-yl)hydroxylamine (PubChem CID 89401722) has the molecular formula C3H2Cl2N4O and a molecular weight of 180.98 g/mol. Its IUPAC name is N-(4,6-dichloro-1,3,5-triazin-2-yl)hydroxylamine.
| Compound Name | N-(4,6-dichloro-1,3,5-triazin-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 89401722 |
| Molecular Formula | C3H2Cl2N4O |
| Molecular Weight | 180.98 g/mol |
| Exact Mass | 179.96 |
| IUPAC Name | N-(4,6-dichloro-1,3,5-triazin-2-yl)hydroxylamine |
| SMILES | ONc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C3H2Cl2N4O/c4-1-6-2(5)8-3(7-1)9-10/h10H,(H,6,7,8,9) |
| InChIKey | IPGGMDBLXNRRSV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.98 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|