C8H7Cl2N9O3 — CID 142028834
(4-amino-6-chloro-1,3,5-triazin-2-yl) 2-[[4-chloro-6-(hydroxyamino)-1,3,5-triazin-2-yl]amino]acetate (PubChem CID 142028834) has the molecular formula C8H7Cl2N9O3 and a molecular weight of 348.11 g/mol. Its IUPAC name is (4-amino-6-chloro-1,3,5-triazin-2-yl) 2-[[4-chloro-6-(hydroxyamino)-1,3,5-triazin-2-yl]amino]acetate.
| Compound Name | (4-amino-6-chloro-1,3,5-triazin-2-yl) 2-[[4-chloro-6-(hydroxyamino)-1,3,5-triazin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 142028834 |
| Molecular Formula | C8H7Cl2N9O3 |
| Molecular Weight | 348.11 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | (4-amino-6-chloro-1,3,5-triazin-2-yl) 2-[[4-chloro-6-(hydroxyamino)-1,3,5-triazin-2-yl]amino]acetate |
| SMILES | Nc1nc(Cl)nc(OC(=O)CNc2nc(Cl)nc(NO)n2)n1 |
| InChI | InChI=1S/C8H7Cl2N9O3/c9-3-13-5(11)17-8(16-3)22-2(20)1-12-6-14-4(10)15-7(18-6)19-21/h21H,1H2,(H2,11,13,16,17)(H2,12,14,15,18,19) |
| InChIKey | KAMRIFWFCMUNMY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 173.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.11 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|