C8H12ClN5O2 — CID 20624439
tert-butyl N-(4-amino-6-chloro-1,3,5-triazin-2-yl)carbamate (PubChem CID 20624439) has the molecular formula C8H12ClN5O2 and a molecular weight of 245.67 g/mol. Its IUPAC name is tert-butyl N-(4-amino-6-chloro-1,3,5-triazin-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-amino-6-chloro-1,3,5-triazin-2-yl)carbamate |
|---|---|
| PubChem CID | 20624439 |
| Molecular Formula | C8H12ClN5O2 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | tert-butyl N-(4-amino-6-chloro-1,3,5-triazin-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C8H12ClN5O2/c1-8(2,3)16-7(15)14-6-12-4(9)11-5(10)13-6/h1-3H3,(H3,10,11,12,13,14,15) |
| InChIKey | UOTWCFZLOZNQLT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |