C8H12N4O3 — CID 20624469
tert-butyl N-(5-formyl-1H-1,2,4-triazol-3-yl)carbamate (PubChem CID 20624469) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is tert-butyl N-(5-formyl-1H-1,2,4-triazol-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-formyl-1H-1,2,4-triazol-3-yl)carbamate |
|---|---|
| PubChem CID | 20624469 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | tert-butyl N-(5-formyl-1H-1,2,4-triazol-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1n[nH]c(C=O)n1 |
| InChI | InChI=1S/C8H12N4O3/c1-8(2,3)15-7(14)10-6-9-5(4-13)11-12-6/h4H,1-3H3,(H2,9,10,11,12,14) |
| InChIKey | ABHLVCFNVPUSCT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|