C11H17BrN2O4S — CID 143508847
tert-butyl N-(5-bromo-4-formyl-1,3-thiazol-2-yl)carbamate;methoxymethane (PubChem CID 143508847) has the molecular formula C11H17BrN2O4S and a molecular weight of 353.24 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-4-formyl-1,3-thiazol-2-yl)carbamate;methoxymethane.
| Compound Name | tert-butyl N-(5-bromo-4-formyl-1,3-thiazol-2-yl)carbamate;methoxymethane |
|---|---|
| PubChem CID | 143508847 |
| Molecular Formula | C11H17BrN2O4S |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | tert-butyl N-(5-bromo-4-formyl-1,3-thiazol-2-yl)carbamate;methoxymethane |
| SMILES | CC(C)(C)OC(=O)Nc1nc(C=O)c(Br)s1.COC |
| InChI | InChI=1S/C9H11BrN2O3S.C2H6O/c1-9(2,3)15-8(14)12-7-11-5(4-13)6(10)16-7;1-3-2/h4H,1-3H3,(H,11,12,14);1-2H3 |
| InChIKey | TVZMUAJEIXTXMN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|