C10H11ClN2O4S — CID 89084735
tert-butyl N-(5-chloro-4-oxaldehydoyl-1,3-thiazol-2-yl)carbamate (PubChem CID 89084735) has the molecular formula C10H11ClN2O4S and a molecular weight of 290.73 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-4-oxaldehydoyl-1,3-thiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-chloro-4-oxaldehydoyl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 89084735 |
| Molecular Formula | C10H11ClN2O4S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | tert-butyl N-(5-chloro-4-oxaldehydoyl-1,3-thiazol-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(C(=O)C=O)c(Cl)s1 |
| InChI | InChI=1S/C10H11ClN2O4S/c1-10(2,3)17-9(16)13-8-12-6(5(15)4-14)7(11)18-8/h4H,1-3H3,(H,12,13,16) |
| InChIKey | HQXKHXRXNISPND-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|