C14H18ClN3O5S — CID 91153201
(2E)-2-[5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-(1-methylcyclopropyl)oxyiminoacetic acid (PubChem CID 91153201) has the molecular formula C14H18ClN3O5S and a molecular weight of 375.83 g/mol. Its IUPAC name is (2E)-2-[5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-(1-methylcyclopropyl)oxyiminoacetic acid.
| Compound Name | (2E)-2-[5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-(1-methylcyclopropyl)oxyiminoacetic acid |
|---|---|
| PubChem CID | 91153201 |
| Molecular Formula | C14H18ClN3O5S |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (2E)-2-[5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-(1-methylcyclopropyl)oxyiminoacetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1nc(/C(=N\OC2(C)CC2)C(=O)O)c(Cl)s1 |
| InChI | InChI=1S/C14H18ClN3O5S/c1-13(2,3)22-12(21)17-11-16-7(9(15)24-11)8(10(19)20)18-23-14(4)5-6-14/h5-6H2,1-4H3,(H,19,20)(H,16,17,21)/b18-8+ |
| InChIKey | NKLOHLLCCABCMH-QGMBQPNBSA-N |
| XLogP | 3.50 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|