C15H20ClN3O5S — CID 91541160
2-[5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-cyclopentyloxyiminoacetic acid (PubChem CID 91541160) has the molecular formula C15H20ClN3O5S and a molecular weight of 389.86 g/mol. Its IUPAC name is 2-[5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-cyclopentyloxyiminoacetic acid.
| Compound Name | 2-[5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-cyclopentyloxyiminoacetic acid |
|---|---|
| PubChem CID | 91541160 |
| Molecular Formula | C15H20ClN3O5S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-[5-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-cyclopentyloxyiminoacetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1nc(C(=NOC2CCCC2)C(=O)O)c(Cl)s1 |
| InChI | InChI=1S/C15H20ClN3O5S/c1-15(2,3)23-14(22)18-13-17-9(11(16)25-13)10(12(20)21)19-24-8-6-4-5-7-8/h8H,4-7H2,1-3H3,(H,20,21)(H,17,18,22) |
| InChIKey | ATXDFEJQTKRZEO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|