C32H33ClN4O5S — CID 72977468
2-[5-chloro-2-(tritylamino)-1,3-thiazol-4-yl]-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxyimino]acetic acid (PubChem CID 72977468) has the molecular formula C32H33ClN4O5S and a molecular weight of 621.16 g/mol. Its IUPAC name is 2-[5-chloro-2-(tritylamino)-1,3-thiazol-4-yl]-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxyimino]acetic acid.
| Compound Name | 2-[5-chloro-2-(tritylamino)-1,3-thiazol-4-yl]-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxyimino]acetic acid |
|---|---|
| PubChem CID | 72977468 |
| Molecular Formula | C32H33ClN4O5S |
| Molecular Weight | 621.16 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | 2-[5-chloro-2-(tritylamino)-1,3-thiazol-4-yl]-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxyimino]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCCON=C(C(=O)O)c1nc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)sc1Cl |
| InChI | InChI=1S/C32H33ClN4O5S/c1-31(2,3)42-30(40)34-20-13-21-41-37-26(28(38)39)25-27(33)43-29(35-25)36-32(22-14-7-4-8-15-22,23-16-9-5-10-17-23)24-18-11-6-12-19-24/h4-12,14-19H,13,20-21H2,1-3H3,(H,34,40)(H,35,36)(H,38,39) |
| InChIKey | RKXNYAYBSWOGDO-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.16 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|