C35H28ClN5O3S — CID 86611316
(2E)-2-[2-[(7-chloroquinolin-4-yl)amino]ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 86611316) has the molecular formula C35H28ClN5O3S and a molecular weight of 634.16 g/mol. Its IUPAC name is (2E)-2-[2-[(7-chloroquinolin-4-yl)amino]ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2E)-2-[2-[(7-chloroquinolin-4-yl)amino]ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 86611316 |
| Molecular Formula | C35H28ClN5O3S |
| Molecular Weight | 634.16 g/mol |
| Exact Mass | 633.16 |
| IUPAC Name | (2E)-2-[2-[(7-chloroquinolin-4-yl)amino]ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)/C(=N/OCCNc1ccnc2cc(Cl)ccc12)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C35H28ClN5O3S/c36-27-16-17-28-29(18-19-37-30(28)22-27)38-20-21-44-41-32(33(42)43)31-23-45-34(39-31)40-35(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-19,22-23H,20-21H2,(H,37,38)(H,39,40)(H,42,43)/b41-32+ |
| InChIKey | VJYATURZNRKNQM-OYRKZILTSA-N |
| XLogP | 7.67 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.16 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|