C39H39F2N3O9S — CID 151407525
2-[[2,5-difluoro-3,4-bis(2-methoxyethoxymethoxy)phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 151407525) has the molecular formula C39H39F2N3O9S and a molecular weight of 763.82 g/mol. Its IUPAC name is 2-[[2,5-difluoro-3,4-bis(2-methoxyethoxymethoxy)phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[[2,5-difluoro-3,4-bis(2-methoxyethoxymethoxy)phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 151407525 |
| Molecular Formula | C39H39F2N3O9S |
| Molecular Weight | 763.82 g/mol |
| Exact Mass | 763.24 |
| IUPAC Name | 2-[[2,5-difluoro-3,4-bis(2-methoxyethoxymethoxy)phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COCCOCOc1c(F)cc(CON=C(C(=O)O)c2csc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)n2)c(F)c1OCOCCOC |
| InChI | InChI=1S/C39H39F2N3O9S/c1-47-18-20-49-25-51-35-31(40)22-27(33(41)36(35)52-26-50-21-19-48-2)23-53-44-34(37(45)46)32-24-54-38(42-32)43-39(28-12-6-3-7-13-28,29-14-8-4-9-15-29)30-16-10-5-11-17-30/h3-17,22,24H,18-21,23,25-26H2,1-2H3,(H,42,43)(H,45,46) |
| InChIKey | OXUVWNKSGVJWGK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.82 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|