C53H51N3O11S — CID 54043218
2-[2-benzhydryloxy-1-[3,4-bis(2-methoxyethoxymethoxy)phenyl]-2-oxoethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 54043218) has the molecular formula C53H51N3O11S and a molecular weight of 938.07 g/mol. Its IUPAC name is 2-[2-benzhydryloxy-1-[3,4-bis(2-methoxyethoxymethoxy)phenyl]-2-oxoethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-benzhydryloxy-1-[3,4-bis(2-methoxyethoxymethoxy)phenyl]-2-oxoethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 54043218 |
| Molecular Formula | C53H51N3O11S |
| Molecular Weight | 938.07 g/mol |
| Exact Mass | 937.32 |
| IUPAC Name | 2-[2-benzhydryloxy-1-[3,4-bis(2-methoxyethoxymethoxy)phenyl]-2-oxoethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COCCOCOc1ccc(C(ON=C(C(=O)O)c2csc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)n2)C(=O)OC(c2ccccc2)c2ccccc2)cc1OCOCCOC |
| InChI | InChI=1S/C53H51N3O11S/c1-60-30-32-62-36-64-45-29-28-40(34-46(45)65-37-63-33-31-61-2)49(51(59)66-48(38-18-8-3-9-19-38)39-20-10-4-11-21-39)67-56-47(50(57)58)44-35-68-52(54-44)55-53(41-22-12-5-13-23-41,42-24-14-6-15-25-42)43-26-16-7-17-27-43/h3-29,34-35,48-49H,30-33,36-37H2,1-2H3,(H,54,55)(H,57,58) |
| InChIKey | LNUHNCGSYKYRBT-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 165.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.07 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|