C56H44N4O6S — CID 19883919
(2Z)-2-[benzhydryloxy-(3-benzhydryloxy-4-oxo-3H-pyridin-6-yl)methoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 19883919) has the molecular formula C56H44N4O6S and a molecular weight of 901.06 g/mol. Its IUPAC name is (2Z)-2-[benzhydryloxy-(3-benzhydryloxy-4-oxo-3H-pyridin-6-yl)methoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2Z)-2-[benzhydryloxy-(3-benzhydryloxy-4-oxo-3H-pyridin-6-yl)methoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 19883919 |
| Molecular Formula | C56H44N4O6S |
| Molecular Weight | 901.06 g/mol |
| Exact Mass | 900.30 |
| IUPAC Name | (2Z)-2-[benzhydryloxy-(3-benzhydryloxy-4-oxo-3H-pyridin-6-yl)methoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)/C(=N\OC(OC(c1ccccc1)c1ccccc1)C1=CC(=O)C(OC(c2ccccc2)c2ccccc2)C=N1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C56H44N4O6S/c61-48-36-46(57-37-49(48)64-51(39-22-8-1-9-23-39)40-24-10-2-11-25-40)54(65-52(41-26-12-3-13-27-41)42-28-14-4-15-29-42)66-60-50(53(62)63)47-38-67-55(58-47)59-56(43-30-16-5-17-31-43,44-32-18-6-19-33-44)45-34-20-7-21-35-45/h1-38,49,51-52,54H,(H,58,59)(H,62,63)/b60-50- |
| InChIKey | OWRXEBIWTBPCGC-BAAQFVISSA-N |
| XLogP | 11.20 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.06 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|