C28H23F3N4O4S — CID 54043026
2-[2-oxo-2-(2,2,2-trifluoroethylamino)ethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 54043026) has the molecular formula C28H23F3N4O4S and a molecular weight of 568.58 g/mol. Its IUPAC name is 2-[2-oxo-2-(2,2,2-trifluoroethylamino)ethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-oxo-2-(2,2,2-trifluoroethylamino)ethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 54043026 |
| Molecular Formula | C28H23F3N4O4S |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 2-[2-oxo-2-(2,2,2-trifluoroethylamino)ethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(CON=C(C(=O)O)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1)NCC(F)(F)F |
| InChI | InChI=1S/C28H23F3N4O4S/c29-27(30,31)18-32-23(36)16-39-35-24(25(37)38)22-17-40-26(33-22)34-28(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,17H,16,18H2,(H,32,36)(H,33,34)(H,37,38) |
| InChIKey | LNRHZNPNXCHSEY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|