C31H23N3O4S — CID 14850487
(2Z)-2-benzoyloxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 14850487) has the molecular formula C31H23N3O4S and a molecular weight of 533.61 g/mol. Its IUPAC name is (2Z)-2-benzoyloxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2Z)-2-benzoyloxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 14850487 |
| Molecular Formula | C31H23N3O4S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | (2Z)-2-benzoyloxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)/C(=N\OC(=O)c1ccccc1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C31H23N3O4S/c35-28(36)27(34-38-29(37)22-13-5-1-6-14-22)26-21-39-30(32-26)33-31(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-21H,(H,32,33)(H,35,36)/b34-27- |
| InChIKey | DEULGDWFJQNDCT-YLHCSOALSA-N |
| XLogP | 6.19 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|