C35H36N4O5S — CID 88697886
N,N-diethylethanamine;(2Z)-2-(furan-2-carbonyloxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 88697886) has the molecular formula C35H36N4O5S and a molecular weight of 624.76 g/mol. Its IUPAC name is N,N-diethylethanamine;(2Z)-2-(furan-2-carbonyloxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | N,N-diethylethanamine;(2Z)-2-(furan-2-carbonyloxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 88697886 |
| Molecular Formula | C35H36N4O5S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | N,N-diethylethanamine;(2Z)-2-(furan-2-carbonyloxyimino)-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCN(CC)CC.O=C(O)/C(=N\OC(=O)c1ccco1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C29H21N3O5S.C6H15N/c33-26(34)25(32-37-27(35)24-17-10-18-36-24)23-19-38-28(30-23)31-29(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22;1-4-7(5-2)6-3/h1-19H,(H,30,31)(H,33,34);4-6H2,1-3H3/b32-25-; |
| InChIKey | BDRBCJPUJKHJNJ-KMHUKDJRSA-N |
| XLogP | 7.13 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|