C34H29N3O5S — CID 54085926
2-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 54085926) has the molecular formula C34H29N3O5S and a molecular weight of 591.69 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 54085926 |
| Molecular Formula | C34H29N3O5S |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 2-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CC1(C)Oc2ccc(CON=C(C(=O)O)c3csc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)n3)cc2O1 |
| InChI | InChI=1S/C34H29N3O5S/c1-33(2)41-28-19-18-23(20-29(28)42-33)21-40-37-30(31(38)39)27-22-43-32(35-27)36-34(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-20,22H,21H2,1-2H3,(H,35,36)(H,38,39) |
| InChIKey | MQLIZQVDAORAPC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|