C29H25N5O3S — CID 88673011
(2E)-2-[(2-methylpyrazol-3-yl)methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 88673011) has the molecular formula C29H25N5O3S and a molecular weight of 523.62 g/mol. Its IUPAC name is (2E)-2-[(2-methylpyrazol-3-yl)methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2E)-2-[(2-methylpyrazol-3-yl)methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 88673011 |
| Molecular Formula | C29H25N5O3S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (2E)-2-[(2-methylpyrazol-3-yl)methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | Cn1nccc1CO/N=C(/C(=O)O)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C29H25N5O3S/c1-34-24(17-18-30-34)19-37-33-26(27(35)36)25-20-38-28(31-25)32-29(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-18,20H,19H2,1H3,(H,31,32)(H,35,36)/b33-26+ |
| InChIKey | NNLHEEXJQWNCCL-MHTZHOPKSA-N |
| XLogP | 5.29 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|