C53H50FN3O11S — CID 139629928
2-[2-benzhydryloxy-1-[4-fluoro-2,3-bis(2-methoxyethoxymethoxy)phenyl]-2-oxoethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 139629928) has the molecular formula C53H50FN3O11S and a molecular weight of 956.06 g/mol. Its IUPAC name is 2-[2-benzhydryloxy-1-[4-fluoro-2,3-bis(2-methoxyethoxymethoxy)phenyl]-2-oxoethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-benzhydryloxy-1-[4-fluoro-2,3-bis(2-methoxyethoxymethoxy)phenyl]-2-oxoethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 139629928 |
| Molecular Formula | C53H50FN3O11S |
| Molecular Weight | 956.06 g/mol |
| Exact Mass | 955.32 |
| IUPAC Name | 2-[2-benzhydryloxy-1-[4-fluoro-2,3-bis(2-methoxyethoxymethoxy)phenyl]-2-oxoethoxy]imino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COCCOCOc1c(F)ccc(C(ON=C(C(=O)O)c2csc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)n2)C(=O)OC(c2ccccc2)c2ccccc2)c1OCOCCOC |
| InChI | InChI=1S/C53H50FN3O11S/c1-61-30-32-63-35-65-47-42(28-29-43(54)49(47)66-36-64-33-31-62-2)48(51(60)67-46(37-18-8-3-9-19-37)38-20-10-4-11-21-38)68-57-45(50(58)59)44-34-69-52(55-44)56-53(39-22-12-5-13-23-39,40-24-14-6-15-25-40)41-26-16-7-17-27-41/h3-29,34,46,48H,30-33,35-36H2,1-2H3,(H,55,56)(H,58,59) |
| InChIKey | HSZDEASFLNFWRV-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 165.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.06 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|