C32H31N3O5S — CID 88627964
(2Z)-2-(1-methoxycarbonylcyclohexyl)oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 88627964) has the molecular formula C32H31N3O5S and a molecular weight of 569.68 g/mol. Its IUPAC name is (2Z)-2-(1-methoxycarbonylcyclohexyl)oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2Z)-2-(1-methoxycarbonylcyclohexyl)oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 88627964 |
| Molecular Formula | C32H31N3O5S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | (2Z)-2-(1-methoxycarbonylcyclohexyl)oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COC(=O)C1(O/N=C(\C(=O)O)c2csc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)n2)CCCCC1 |
| InChI | InChI=1S/C32H31N3O5S/c1-39-29(38)31(20-12-5-13-21-31)40-35-27(28(36)37)26-22-41-30(33-26)34-32(23-14-6-2-7-15-23,24-16-8-3-9-17-24)25-18-10-4-11-19-25/h2-4,6-11,14-19,22H,5,12-13,20-21H2,1H3,(H,33,34)(H,36,37)/b35-27- |
| InChIKey | JCOCPAUAAWTJKQ-LSWMGQQCSA-N |
| XLogP | 6.23 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|