C33H33N3O5S — CID 154239117
2-(1-butoxycarbonylcyclobutyl)oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 154239117) has the molecular formula C33H33N3O5S and a molecular weight of 583.71 g/mol. Its IUPAC name is 2-(1-butoxycarbonylcyclobutyl)oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-(1-butoxycarbonylcyclobutyl)oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 154239117 |
| Molecular Formula | C33H33N3O5S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | 2-(1-butoxycarbonylcyclobutyl)oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCCCOC(=O)C1(ON=C(C(=O)O)c2csc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)n2)CCC1 |
| InChI | InChI=1S/C33H33N3O5S/c1-2-3-22-40-30(39)32(20-13-21-32)41-36-28(29(37)38)27-23-42-31(34-27)35-33(24-14-7-4-8-15-24,25-16-9-5-10-17-25)26-18-11-6-12-19-26/h4-12,14-19,23H,2-3,13,20-22H2,1H3,(H,34,35)(H,37,38) |
| InChIKey | JXDNXNSUPJRROF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|