C47H40ClN3O7S — CID 88610985
(2Z)-2-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 88610985) has the molecular formula C47H40ClN3O7S and a molecular weight of 826.37 g/mol. Its IUPAC name is (2Z)-2-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2Z)-2-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 88610985 |
| Molecular Formula | C47H40ClN3O7S |
| Molecular Weight | 826.37 g/mol |
| Exact Mass | 825.23 |
| IUPAC Name | (2Z)-2-[[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccc(COc2ccc(CO/N=C(\C(=O)O)c3csc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C47H40ClN3O7S/c1-54-38-23-18-32(19-24-38)28-56-41-27-22-34(42(48)44(41)57-29-33-20-25-39(55-2)26-21-33)30-58-51-43(45(52)53)40-31-59-46(49-40)50-47(35-12-6-3-7-13-35,36-14-8-4-9-15-36)37-16-10-5-11-17-37/h3-27,31H,28-30H2,1-2H3,(H,49,50)(H,52,53)/b51-43- |
| InChIKey | ZEYFFWFCPGYHJK-QHTNNWRJSA-N |
| XLogP | 10.38 |
| TPSA | 120.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.37 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|