C9H9Cl2N3O4S — CID 22817763
(2E)-2-[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetic acid (PubChem CID 22817763) has the molecular formula C9H9Cl2N3O4S and a molecular weight of 326.16 g/mol. Its IUPAC name is (2E)-2-[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetic acid.
| Compound Name | (2E)-2-[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetic acid |
|---|---|
| PubChem CID | 22817763 |
| Molecular Formula | C9H9Cl2N3O4S |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | (2E)-2-[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-ethoxyiminoacetic acid |
| SMILES | CCO/N=C(/C(=O)O)c1nc(NC(=O)CCl)sc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O4S/c1-2-18-14-6(8(16)17)5-7(11)19-9(13-5)12-4(15)3-10/h2-3H2,1H3,(H,16,17)(H,12,13,15)/b14-6+ |
| InChIKey | SNTGEWKWHWTJDB-MKMNVTDBSA-N |
| XLogP | 1.80 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|