C8H8ClFN2O3S — CID 21138942
(2Z)-2-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetic acid (PubChem CID 21138942) has the molecular formula C8H8ClFN2O3S and a molecular weight of 266.68 g/mol. Its IUPAC name is (2Z)-2-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetic acid.
| Compound Name | (2Z)-2-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetic acid |
|---|---|
| PubChem CID | 21138942 |
| Molecular Formula | C8H8ClFN2O3S |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | (2Z)-2-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetic acid |
| SMILES | Cc1nc(/C(=N/OCCF)C(=O)O)c(Cl)s1 |
| InChI | InChI=1S/C8H8ClFN2O3S/c1-4-11-5(7(9)16-4)6(8(13)14)12-15-3-2-10/h2-3H2,1H3,(H,13,14)/b12-6- |
| InChIKey | SNPVRTJWJUPORD-SDQBBNPISA-N |
| XLogP | 1.88 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|