C8H10N2O4S — CID 135193915
(2Z)-2-(2-hydroxyethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetic acid (PubChem CID 135193915) has the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. Its IUPAC name is (2Z)-2-(2-hydroxyethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetic acid.
| Compound Name | (2Z)-2-(2-hydroxyethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 135193915 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (2Z)-2-(2-hydroxyethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetic acid |
| SMILES | Cc1nc(/C(=N/OCCO)C(=O)O)cs1 |
| InChI | InChI=1S/C8H10N2O4S/c1-5-9-6(4-15-5)7(8(12)13)10-14-3-2-11/h4,11H,2-3H2,1H3,(H,12,13)/b10-7- |
| InChIKey | OCZFSCYPVICTES-YFHOEESVSA-N |
| XLogP | 0.25 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|