C7H7AsN2O5S — CID 173284924
2-(2-arsanyl-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetic acid (PubChem CID 173284924) has the molecular formula C7H7AsN2O5S and a molecular weight of 306.13 g/mol. Its IUPAC name is 2-(2-arsanyl-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetic acid.
| Compound Name | 2-(2-arsanyl-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetic acid |
|---|---|
| PubChem CID | 173284924 |
| Molecular Formula | C7H7AsN2O5S |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 2-(2-arsanyl-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetic acid |
| SMILES | O=C(O)CON=C(C(=O)O)c1csc([AsH2])n1 |
| InChI | InChI=1S/C7H7AsN2O5S/c8-7-9-3(2-16-7)5(6(13)14)10-15-1-4(11)12/h2H,1,8H2,(H,11,12)(H,13,14) |
| InChIKey | JJIVSQHXDIAZSP-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|