C8H10N4O4S — CID 21286885
(2Z)-2-(2-aminoethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetic acid (PubChem CID 21286885) has the molecular formula C8H10N4O4S and a molecular weight of 258.26 g/mol. Its IUPAC name is (2Z)-2-(2-aminoethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetic acid.
| Compound Name | (2Z)-2-(2-aminoethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 21286885 |
| Molecular Formula | C8H10N4O4S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (2Z)-2-(2-aminoethoxyimino)-2-(2-formamido-1,3-thiazol-4-yl)acetic acid |
| SMILES | NCCO/N=C(\C(=O)O)c1csc(NC=O)n1 |
| InChI | InChI=1S/C8H10N4O4S/c9-1-2-16-12-6(7(14)15)5-3-17-8(11-5)10-4-13/h3-4H,1-2,9H2,(H,14,15)(H,10,11,13)/b12-6- |
| InChIKey | UWZMXJLQQLSSMG-SDQBBNPISA-N |
| XLogP | -0.52 |
| TPSA | 126.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|