C5H7FN4O4S — CID 131719032
2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(fluoromethoxyimino)acetic acid;hydrate (PubChem CID 131719032) has the molecular formula C5H7FN4O4S and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(fluoromethoxyimino)acetic acid;hydrate.
| Compound Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(fluoromethoxyimino)acetic acid;hydrate |
|---|---|
| PubChem CID | 131719032 |
| Molecular Formula | C5H7FN4O4S |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(fluoromethoxyimino)acetic acid;hydrate |
| SMILES | Nc1nc(C(=NOCF)C(=O)O)ns1.O |
| InChI | InChI=1S/C5H5FN4O3S.H2O/c6-1-13-9-2(4(11)12)3-8-5(7)14-10-3;/h1H2,(H,11,12)(H2,7,8,10);1H2 |
| InChIKey | LGBQQJBZPKBQHH-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|