C7H6N4O3S — CID 54294179
2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-ynoxyiminoacetic acid (PubChem CID 54294179) has the molecular formula C7H6N4O3S and a molecular weight of 226.22 g/mol. Its IUPAC name is 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-ynoxyiminoacetic acid.
| Compound Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-ynoxyiminoacetic acid |
|---|---|
| PubChem CID | 54294179 |
| Molecular Formula | C7H6N4O3S |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-prop-2-ynoxyiminoacetic acid |
| SMILES | C#CCON=C(C(=O)O)c1nsc(N)n1 |
| InChI | InChI=1S/C7H6N4O3S/c1-2-3-14-10-4(6(12)13)5-9-7(8)15-11-5/h1H,3H2,(H,12,13)(H2,8,9,11) |
| InChIKey | RZPVDLOPOFEDGV-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|