C6H7N5O4S — CID 54419439
2-[[2-amino-1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxyacetic acid (PubChem CID 54419439) has the molecular formula C6H7N5O4S and a molecular weight of 245.22 g/mol. Its IUPAC name is 2-[[2-amino-1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxyacetic acid.
| Compound Name | 2-[[2-amino-1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 54419439 |
| Molecular Formula | C6H7N5O4S |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 2-[[2-amino-1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxyacetic acid |
| SMILES | NC(=O)C(=NOCC(=O)O)c1nsc(N)n1 |
| InChI | InChI=1S/C6H7N5O4S/c7-4(14)3(10-15-1-2(12)13)5-9-6(8)16-11-5/h1H2,(H2,7,14)(H,12,13)(H2,8,9,11) |
| InChIKey | CFEFNAFEZBCMFA-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|