C7H7N3O4S — CID 138517478
(Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)pent-2-enedioic acid (PubChem CID 138517478) has the molecular formula C7H7N3O4S and a molecular weight of 229.22 g/mol. Its IUPAC name is (Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)pent-2-enedioic acid.
| Compound Name | (Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)pent-2-enedioic acid |
|---|---|
| PubChem CID | 138517478 |
| Molecular Formula | C7H7N3O4S |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | (Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)pent-2-enedioic acid |
| SMILES | Nc1nc(/C(=C/CC(=O)O)C(=O)O)ns1 |
| InChI | InChI=1S/C7H7N3O4S/c8-7-9-5(10-15-7)3(6(13)14)1-2-4(11)12/h1H,2H2,(H,11,12)(H,13,14)(H2,8,9,10)/b3-1- |
| InChIKey | PZSHKAMZSXYFMJ-IWQZZHSRSA-N |
| XLogP | 0.06 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|