C7H9FN4O3S — CID 14477682
ethyl (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(fluoromethoxyimino)acetate (PubChem CID 14477682) has the molecular formula C7H9FN4O3S and a molecular weight of 248.24 g/mol. Its IUPAC name is ethyl (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(fluoromethoxyimino)acetate.
| Compound Name | ethyl (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(fluoromethoxyimino)acetate |
|---|---|
| PubChem CID | 14477682 |
| Molecular Formula | C7H9FN4O3S |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | ethyl (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(fluoromethoxyimino)acetate |
| SMILES | CCOC(=O)/C(=N\OCF)c1nsc(N)n1 |
| InChI | InChI=1S/C7H9FN4O3S/c1-2-14-6(13)4(11-15-3-8)5-10-7(9)16-12-5/h2-3H2,1H3,(H2,9,10,12)/b11-4- |
| InChIKey | BGQLMEZSSCABOI-WCIBSUBMSA-N |
| XLogP | 0.33 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|