C24H20N4O3S — CID 59541610
methyl 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-trityloxyiminoacetate (PubChem CID 59541610) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is methyl 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-trityloxyiminoacetate.
| Compound Name | methyl 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-trityloxyiminoacetate |
|---|---|
| PubChem CID | 59541610 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | methyl 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-trityloxyiminoacetate |
| SMILES | COC(=O)C(=NOC(c1ccccc1)(c1ccccc1)c1ccccc1)c1nsc(N)n1 |
| InChI | InChI=1S/C24H20N4O3S/c1-30-22(29)20(21-26-23(25)32-28-21)27-31-24(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3,(H2,25,26,28) |
| InChIKey | RDQTZOHEPUNOHT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|