C28H26N4O5S — CID 18659168
(2E)-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-trityloxyiminoacetic acid (PubChem CID 18659168) has the molecular formula C28H26N4O5S and a molecular weight of 530.61 g/mol. Its IUPAC name is (2E)-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-trityloxyiminoacetic acid.
| Compound Name | (2E)-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-trityloxyiminoacetic acid |
|---|---|
| PubChem CID | 18659168 |
| Molecular Formula | C28H26N4O5S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | (2E)-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-trityloxyiminoacetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1nc(/C(=N\OC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)O)ns1 |
| InChI | InChI=1S/C28H26N4O5S/c1-27(2,3)36-26(35)30-25-29-23(32-38-25)22(24(33)34)31-37-28(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3,(H,33,34)(H,29,30,32,35)/b31-22+ |
| InChIKey | YMWFMHZSYAVTDN-DFKUXCBWSA-N |
| XLogP | 5.68 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|