C13H16N4O5S — CID 72729002
methyl 2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-prop-2-ynoxyiminoacetate (PubChem CID 72729002) has the molecular formula C13H16N4O5S and a molecular weight of 340.36 g/mol. Its IUPAC name is methyl 2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-prop-2-ynoxyiminoacetate.
| Compound Name | methyl 2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-prop-2-ynoxyiminoacetate |
|---|---|
| PubChem CID | 72729002 |
| Molecular Formula | C13H16N4O5S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | methyl 2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-prop-2-ynoxyiminoacetate |
| SMILES | C#CCON=C(C(=O)OC)c1nsc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C13H16N4O5S/c1-6-7-21-16-8(10(18)20-5)9-14-11(23-17-9)15-12(19)22-13(2,3)4/h1H,7H2,2-5H3,(H,14,15,17,19) |
| InChIKey | DUBYLCHUVCHBIJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|